C26H28O — CID 101258013
(3R)-4-(4-tert-butylphenyl)-1,3-diphenylbutan-1-one (PubChem CID 101258013) has the molecular formula C26H28O and a molecular weight of 356.51 g/mol. Its IUPAC name is (3R)-4-(4-tert-butylphenyl)-1,3-diphenylbutan-1-one.
| Compound Name | (3R)-4-(4-tert-butylphenyl)-1,3-diphenylbutan-1-one |
|---|---|
| PubChem CID | 101258013 |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (3R)-4-(4-tert-butylphenyl)-1,3-diphenylbutan-1-one |
| SMILES | CC(C)(C)c1ccc(C[C@H](CC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O/c1-26(2,3)24-16-14-20(15-17-24)18-23(21-10-6-4-7-11-21)19-25(27)22-12-8-5-9-13-22/h4-17,23H,18-19H2,1-3H3/t23-/m1/s1 |
| InChIKey | RYXIHDKVPQUKHK-HSZRJFAPSA-N |
| XLogP | 6.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |