C24H33AlO — CID 173147077
1-octylalumanyl-3,4-diphenylbutan-2-one (PubChem CID 173147077) has the molecular formula C24H33AlO and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-octylalumanyl-3,4-diphenylbutan-2-one.
| Compound Name | 1-octylalumanyl-3,4-diphenylbutan-2-one |
|---|---|
| PubChem CID | 173147077 |
| Molecular Formula | C24H33AlO |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-octylalumanyl-3,4-diphenylbutan-2-one |
| SMILES | CCCCCCCC[AlH]CC(=O)C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15O.C8H17.Al.H/c1-13(17)16(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14;1-3-5-7-8-6-4-2;;/h2-11,16H,1,12H2;1,3-8H2,2H3;; |
| InChIKey | XPDBAWHDIRZGNK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|