C11H15FNO2+ — CID 91928909
[(2S,3S)-4-carboxy-1-fluoro-3-phenylbutan-2-yl]azanium (PubChem CID 91928909) has the molecular formula C11H15FNO2+ and a molecular weight of 212.24 g/mol. Its IUPAC name is [(2S,3S)-4-carboxy-1-fluoro-3-phenylbutan-2-yl]azanium.
| Compound Name | [(2S,3S)-4-carboxy-1-fluoro-3-phenylbutan-2-yl]azanium |
|---|---|
| PubChem CID | 91928909 |
| Molecular Formula | C11H15FNO2+ |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [(2S,3S)-4-carboxy-1-fluoro-3-phenylbutan-2-yl]azanium |
| SMILES | [NH3+][C@H](CF)[C@@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H14FNO2/c12-7-10(13)9(6-11(14)15)8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2,(H,14,15)/p+1/t9-,10+/m0/s1 |
| InChIKey | AAUAOUBSUMPGRM-VHSXEESVSA-O |
| XLogP | 0.82 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |