C27H50NO4P — CID 142029020
N-tert-butyl-1-[ethoxy(prop-1-en-2-yloxy)phosphoryl]-N,2,2-trimethylpropan-1-amine;1-propan-2-yloxypropan-2-ylbenzene (PubChem CID 142029020) has the molecular formula C27H50NO4P and a molecular weight of 483.67 g/mol. Its IUPAC name is N-tert-butyl-1-[ethoxy(prop-1-en-2-yloxy)phosphoryl]-N,2,2-trimethylpropan-1-amine;1-propan-2-yloxypropan-2-ylbenzene.
| Compound Name | N-tert-butyl-1-[ethoxy(prop-1-en-2-yloxy)phosphoryl]-N,2,2-trimethylpropan-1-amine;1-propan-2-yloxypropan-2-ylbenzene |
|---|---|
| PubChem CID | 142029020 |
| Molecular Formula | C27H50NO4P |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | N-tert-butyl-1-[ethoxy(prop-1-en-2-yloxy)phosphoryl]-N,2,2-trimethylpropan-1-amine;1-propan-2-yloxypropan-2-ylbenzene |
| SMILES | C=C(C)OP(=O)(OCC)C(N(C)C(C)(C)C)C(C)(C)C.CC(C)OCC(C)c1ccccc1 |
| InChI | InChI=1S/C15H32NO3P.C12H18O/c1-11-18-20(17,19-12(2)3)13(14(4,5)6)16(10)15(7,8)9;1-10(2)13-9-11(3)12-7-5-4-6-8-12/h13H,2,11H2,1,3-10H3;4-8,10-11H,9H2,1-3H3 |
| InChIKey | WVZDCALNMPJSOR-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|