C13H30NO4P — CID 23143931
N-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine (PubChem CID 23143931) has the molecular formula C13H30NO4P and a molecular weight of 295.36 g/mol. Its IUPAC name is N-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine.
| Compound Name | N-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine |
|---|---|
| PubChem CID | 23143931 |
| Molecular Formula | C13H30NO4P |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-butyl-N-(1-diethoxyphosphoryl-2,2-dimethylpropyl)hydroxylamine |
| SMILES | CCCCN(O)C(C(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H30NO4P/c1-7-10-11-14(15)12(13(4,5)6)19(16,17-8-2)18-9-3/h12,15H,7-11H2,1-6H3 |
| InChIKey | GAKKQTRAAHSZHX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|