C12H28INO4P- — CID 163552966
N-tert-butyl-N-[1-[ethoxy(methyliodanuidyloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine (PubChem CID 163552966) has the molecular formula C12H28INO4P- and a molecular weight of 408.24 g/mol. Its IUPAC name is N-tert-butyl-N-[1-[ethoxy(methyliodanuidyloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine.
| Compound Name | N-tert-butyl-N-[1-[ethoxy(methyliodanuidyloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine |
|---|---|
| PubChem CID | 163552966 |
| Molecular Formula | C12H28INO4P- |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-tert-butyl-N-[1-[ethoxy(methyliodanuidyloxy)phosphoryl]-2,2-dimethylpropyl]hydroxylamine |
| SMILES | CCOP(=O)(O[I-]C)C(N(O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H28INO4P/c1-9-17-19(16,18-13-8)10(11(2,3)4)14(15)12(5,6)7/h10,15H,9H2,1-8H3/q-1 |
| InChIKey | QUNMDTMORVEIFS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|