About CID 102049156
CID 102049156 (PubChem CID 102049156) has the molecular formula C16H35NO4P
and a molecular weight of 336.43 g/mol.
Molecular Properties
| Compound Name | CID 102049156 |
| PubChem CID | 102049156 |
| Molecular Formula | C16H35NO4P |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)C(N([O])C(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H35NO4P/c1-8-12-13-14(9-2)15(17(18)16(5,6)7)22(19,20-10-3)21-11-4/h14-15H,8-13H2,1-7H3 |
| InChIKey | UJKNEISPBBNBEG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102049156 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102049156?
The IUPAC name of CID 102049156 (CID 102049156) is not available.
What is the SMILES notation for CID 102049156?
The canonical SMILES for CID 102049156 is CCCCC(CC)C(N([O])C(C)(C)C)P(=O)(OCC)OCC.
What is the InChIKey of CID 102049156?
The InChIKey is UJKNEISPBBNBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35NO4P/c1-8-12-13-14(9-2)15(17(18)16(5,6)7)22(19,20-10-3)21-11-4/h14-15H,8-13H2,1-7H3.
What are the key properties of CID 102049156?
CID 102049156 has a molecular weight of 336.43 g/mol, XLogP of 5.24, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102049156 is sourced from PubChem (CID 102049156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).