About CID 135068750
CID 135068750 (PubChem CID 135068750) has the molecular formula C13H30BO5P2+
and a molecular weight of 339.14 g/mol.
Molecular Properties
| Compound Name | CID 135068750 |
| PubChem CID | 135068750 |
| Molecular Formula | C13H30BO5P2+ |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | — |
| SMILES | [B][P+](OCC)(OCC)C(CCCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H30BO5P2/c1-6-11-12-13(20(14,16-7-2)17-8-3)21(15,18-9-4)19-10-5/h13H,6-12H2,1-5H3/q+1 |
| InChIKey | HNLMFALOCJLKBZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 135068750 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135068750?
The IUPAC name of CID 135068750 (CID 135068750) is not available.
What is the SMILES notation for CID 135068750?
The canonical SMILES for CID 135068750 is [B][P+](OCC)(OCC)C(CCCC)P(=O)(OCC)OCC.
What is the InChIKey of CID 135068750?
The InChIKey is HNLMFALOCJLKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30BO5P2/c1-6-11-12-13(20(14,16-7-2)17-8-3)21(15,18-9-4)19-10-5/h13H,6-12H2,1-5H3/q+1.
What are the key properties of CID 135068750?
CID 135068750 has a molecular weight of 339.14 g/mol, XLogP of 4.77, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135068750 is sourced from PubChem (CID 135068750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).