C24H50NO4P — CID 101240602
N-tert-butyl-1-diethoxyphosphoryl-N-[[(1S,2S)-2-(2,2-dimethylpropyl)cyclopentyl]methoxy]-2,2-dimethylpropan-1-amine (PubChem CID 101240602) has the molecular formula C24H50NO4P and a molecular weight of 447.64 g/mol. Its IUPAC name is N-tert-butyl-1-diethoxyphosphoryl-N-[[(1S,2S)-2-(2,2-dimethylpropyl)cyclopentyl]methoxy]-2,2-dimethylpropan-1-amine.
| Compound Name | N-tert-butyl-1-diethoxyphosphoryl-N-[[(1S,2S)-2-(2,2-dimethylpropyl)cyclopentyl]methoxy]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 101240602 |
| Molecular Formula | C24H50NO4P |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | N-tert-butyl-1-diethoxyphosphoryl-N-[[(1S,2S)-2-(2,2-dimethylpropyl)cyclopentyl]methoxy]-2,2-dimethylpropan-1-amine |
| SMILES | CCOP(=O)(OCC)C(N(OC[C@H]1CCC[C@H]1CC(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H50NO4P/c1-12-28-30(26,29-13-2)21(23(6,7)8)25(24(9,10)11)27-18-20-16-14-15-19(20)17-22(3,4)5/h19-21H,12-18H2,1-11H3/t19-,20+,21?/m0/s1 |
| InChIKey | FRGWOPUVWFRGQC-MCOCGALXSA-N |
| XLogP | 7.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|