C9H23O4PSi — CID 57271043
ethoxy-[3-[methoxy(methyl)phosphoryl]oxypropyl]-dimethylsilane (PubChem CID 57271043) has the molecular formula C9H23O4PSi and a molecular weight of 254.34 g/mol. Its IUPAC name is ethoxy-[3-[methoxy(methyl)phosphoryl]oxypropyl]-dimethylsilane.
| Compound Name | ethoxy-[3-[methoxy(methyl)phosphoryl]oxypropyl]-dimethylsilane |
|---|---|
| PubChem CID | 57271043 |
| Molecular Formula | C9H23O4PSi |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethoxy-[3-[methoxy(methyl)phosphoryl]oxypropyl]-dimethylsilane |
| SMILES | CCO[Si](C)(C)CCCOP(C)(=O)OC |
| InChI | InChI=1S/C9H23O4PSi/c1-6-13-15(4,5)9-7-8-12-14(3,10)11-2/h6-9H2,1-5H3 |
| InChIKey | JDLHSRMEDDSYRA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|