About butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid
butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid (PubChem CID 87842087) has the molecular formula C14H31F2O6PSi
and a molecular weight of 392.45 g/mol. Its IUPAC name is butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid.
Molecular Properties
| Compound Name | butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid |
| PubChem CID | 87842087 |
| Molecular Formula | C14H31F2O6PSi |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid |
| SMILES | CCO[Si](CCCC(F)(F)P(=O)(O)OC(C)CC)(OCC)OCC |
| InChI | InChI=1S/C14H31F2O6PSi/c1-6-13(5)22-23(17,18)14(15,16)11-10-12-24(19-7-2,20-8-3)21-9-4/h13H,6-12H2,1-5H3,(H,17,18) |
| InChIKey | MIHYDRPKQKHWEL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid?
The IUPAC name of butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid (CID 87842087) is butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid.
What is the SMILES notation for butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid?
The canonical SMILES for butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid is CCO[Si](CCCC(F)(F)P(=O)(O)OC(C)CC)(OCC)OCC.
What is the InChIKey of butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid?
The InChIKey is MIHYDRPKQKHWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31F2O6PSi/c1-6-13(5)22-23(17,18)14(15,16)11-10-12-24(19-7-2,20-8-3)21-9-4/h13H,6-12H2,1-5H3,(H,17,18).
What are the key properties of butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid?
butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid has a molecular weight of 392.45 g/mol, XLogP of 4.41, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid is sourced from PubChem (CID 87842087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).