C14H31F2O6PSi — CID 87842087
butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid (PubChem CID 87842087) has the molecular formula C14H31F2O6PSi and a molecular weight of 392.45 g/mol. Its IUPAC name is butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid.
| Compound Name | butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 87842087 |
| Molecular Formula | C14H31F2O6PSi |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | butan-2-yloxy-(1,1-difluoro-4-triethoxysilylbutyl)phosphinic acid |
| SMILES | CCO[Si](CCCC(F)(F)P(=O)(O)OC(C)CC)(OCC)OCC |
| InChI | InChI=1S/C14H31F2O6PSi/c1-6-13(5)22-23(17,18)14(15,16)11-10-12-24(19-7-2,20-8-3)21-9-4/h13H,6-12H2,1-5H3,(H,17,18) |
| InChIKey | MIHYDRPKQKHWEL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|