C30H64N2O10Si2 — CID 54112188
[10-carbamoyloxy-13-triethoxysilyl-10-(3-triethoxysilylpropyl)tridecyl] carbamate (PubChem CID 54112188) has the molecular formula C30H64N2O10Si2 and a molecular weight of 669.02 g/mol. Its IUPAC name is [10-carbamoyloxy-13-triethoxysilyl-10-(3-triethoxysilylpropyl)tridecyl] carbamate.
| Compound Name | [10-carbamoyloxy-13-triethoxysilyl-10-(3-triethoxysilylpropyl)tridecyl] carbamate |
|---|---|
| PubChem CID | 54112188 |
| Molecular Formula | C30H64N2O10Si2 |
| Molecular Weight | 669.02 g/mol |
| Exact Mass | 668.41 |
| IUPAC Name | [10-carbamoyloxy-13-triethoxysilyl-10-(3-triethoxysilylpropyl)tridecyl] carbamate |
| SMILES | CCO[Si](CCCC(CCCCCCCCCOC(N)=O)(CCC[Si](OCC)(OCC)OCC)OC(N)=O)(OCC)OCC |
| InChI | InChI=1S/C30H64N2O10Si2/c1-7-36-43(37-8-2,38-9-3)26-20-23-30(42-29(32)34,22-18-16-14-13-15-17-19-25-35-28(31)33)24-21-27-44(39-10-4,40-11-5)41-12-6/h7-27H2,1-6H3,(H2,31,33)(H2,32,34) |
| InChIKey | NHWXKPQRWCOVLD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.02 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|