C13H30N2O4Si — CID 87282445
(2-methyl-5-triethoxysilylpentan-2-yl)urea (PubChem CID 87282445) has the molecular formula C13H30N2O4Si and a molecular weight of 306.48 g/mol. Its IUPAC name is (2-methyl-5-triethoxysilylpentan-2-yl)urea.
| Compound Name | (2-methyl-5-triethoxysilylpentan-2-yl)urea |
|---|---|
| PubChem CID | 87282445 |
| Molecular Formula | C13H30N2O4Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2-methyl-5-triethoxysilylpentan-2-yl)urea |
| SMILES | CCO[Si](CCCC(C)(C)NC(N)=O)(OCC)OCC |
| InChI | InChI=1S/C13H30N2O4Si/c1-6-17-20(18-7-2,19-8-3)11-9-10-13(4,5)15-12(14)16/h6-11H2,1-5H3,(H3,14,15,16) |
| InChIKey | HRJUAAMKRJYKHV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|