C19H42O5Si2 — CID 86039074
triethylsilyl 2,2-dimethyl-5-triethoxysilylpentanoate (PubChem CID 86039074) has the molecular formula C19H42O5Si2 and a molecular weight of 406.71 g/mol. Its IUPAC name is triethylsilyl 2,2-dimethyl-5-triethoxysilylpentanoate.
| Compound Name | triethylsilyl 2,2-dimethyl-5-triethoxysilylpentanoate |
|---|---|
| PubChem CID | 86039074 |
| Molecular Formula | C19H42O5Si2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | triethylsilyl 2,2-dimethyl-5-triethoxysilylpentanoate |
| SMILES | CCO[Si](CCCC(C)(C)C(=O)O[Si](CC)(CC)CC)(OCC)OCC |
| InChI | InChI=1S/C19H42O5Si2/c1-9-21-26(22-10-2,23-11-3)17-15-16-19(7,8)18(20)24-25(12-4,13-5)14-6/h9-17H2,1-8H3 |
| InChIKey | ULLNCXUDAMBLNF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|