C16H36O4Si2 — CID 87832662
triethylsilyl 5-[dimethoxy(methyl)silyl]-2,2-dimethylpentanoate (PubChem CID 87832662) has the molecular formula C16H36O4Si2 and a molecular weight of 348.63 g/mol. Its IUPAC name is triethylsilyl 5-[dimethoxy(methyl)silyl]-2,2-dimethylpentanoate.
| Compound Name | triethylsilyl 5-[dimethoxy(methyl)silyl]-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 87832662 |
| Molecular Formula | C16H36O4Si2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | triethylsilyl 5-[dimethoxy(methyl)silyl]-2,2-dimethylpentanoate |
| SMILES | CC[Si](CC)(CC)OC(=O)C(C)(C)CCC[Si](C)(OC)OC |
| InChI | InChI=1S/C16H36O4Si2/c1-9-22(10-2,11-3)20-15(17)16(4,5)13-12-14-21(8,18-6)19-7/h9-14H2,1-8H3 |
| InChIKey | BRNKGHPXRVJTQX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|