C30H70N2O9Si3 — CID 172719348
6-triethoxysilyl-2,3-bis(3-triethoxysilylpropyl)hexane-1,3-diamine (PubChem CID 172719348) has the molecular formula C30H70N2O9Si3 and a molecular weight of 687.15 g/mol. Its IUPAC name is 6-triethoxysilyl-2,3-bis(3-triethoxysilylpropyl)hexane-1,3-diamine.
| Compound Name | 6-triethoxysilyl-2,3-bis(3-triethoxysilylpropyl)hexane-1,3-diamine |
|---|---|
| PubChem CID | 172719348 |
| Molecular Formula | C30H70N2O9Si3 |
| Molecular Weight | 687.15 g/mol |
| Exact Mass | 686.44 |
| IUPAC Name | 6-triethoxysilyl-2,3-bis(3-triethoxysilylpropyl)hexane-1,3-diamine |
| SMILES | CCO[Si](CCCC(CN)C(N)(CCC[Si](OCC)(OCC)OCC)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C30H70N2O9Si3/c1-10-33-42(34-11-2,35-12-3)25-19-22-29(28-31)30(32,23-20-26-43(36-13-4,37-14-5)38-15-6)24-21-27-44(39-16-7,40-17-8)41-18-9/h29H,10-28,31-32H2,1-9H3 |
| InChIKey | GHGRWWDDTFTKIN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 135.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|