C29H58O12P2Si2 — CID 141360578
[4,4-bis[bis(cyclopropylmethoxy)phosphoryl]-7-trimethoxysilylheptyl]-trimethoxysilane (PubChem CID 141360578) has the molecular formula C29H58O12P2Si2 and a molecular weight of 716.89 g/mol. Its IUPAC name is [4,4-bis[bis(cyclopropylmethoxy)phosphoryl]-7-trimethoxysilylheptyl]-trimethoxysilane.
| Compound Name | [4,4-bis[bis(cyclopropylmethoxy)phosphoryl]-7-trimethoxysilylheptyl]-trimethoxysilane |
|---|---|
| PubChem CID | 141360578 |
| Molecular Formula | C29H58O12P2Si2 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | [4,4-bis[bis(cyclopropylmethoxy)phosphoryl]-7-trimethoxysilylheptyl]-trimethoxysilane |
| SMILES | CO[Si](CCCC(CCC[Si](OC)(OC)OC)(P(=O)(OCC1CC1)OCC1CC1)P(=O)(OCC1CC1)OCC1CC1)(OC)OC |
| InChI | InChI=1S/C29H58O12P2Si2/c1-32-44(33-2,34-3)19-7-17-29(18-8-20-45(35-4,36-5)37-6,42(30,38-21-25-9-10-25)39-22-26-11-12-26)43(31,40-23-27-13-14-27)41-24-28-15-16-28/h25-28H,7-24H2,1-6H3 |
| InChIKey | URLILFQWYQSQKO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|