C38H80O3Si — CID 154020253
2,2-dioctyldecoxy-diethoxy-octylsilane (PubChem CID 154020253) has the molecular formula C38H80O3Si and a molecular weight of 613.14 g/mol. Its IUPAC name is 2,2-dioctyldecoxy-diethoxy-octylsilane.
| Compound Name | 2,2-dioctyldecoxy-diethoxy-octylsilane |
|---|---|
| PubChem CID | 154020253 |
| Molecular Formula | C38H80O3Si |
| Molecular Weight | 613.14 g/mol |
| Exact Mass | 612.59 |
| IUPAC Name | 2,2-dioctyldecoxy-diethoxy-octylsilane |
| SMILES | CCCCCCCCC(CCCCCCCC)(CCCCCCCC)CO[Si](CCCCCCCC)(OCC)OCC |
| InChI | InChI=1S/C38H80O3Si/c1-7-13-17-21-25-29-33-38(34-30-26-22-18-14-8-2,35-31-27-23-19-15-9-3)37-41-42(39-11-5,40-12-6)36-32-28-24-20-16-10-4/h7-37H2,1-6H3 |
| InChIKey | KNJVDKQEOJLGJZ-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.14 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|