About N,N-diethylpentan-3-amine;hydrobromide
N,N-diethylpentan-3-amine;hydrobromide (PubChem CID 175223065) has the molecular formula C9H22BrN
and a molecular weight of 224.19 g/mol. Its IUPAC name is N,N-diethylpentan-3-amine;hydrobromide.
Molecular Properties
| Compound Name | N,N-diethylpentan-3-amine;hydrobromide |
| PubChem CID | 175223065 |
| Molecular Formula | C9H22BrN |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N,N-diethylpentan-3-amine;hydrobromide |
| SMILES | Br.CCC(CC)N(CC)CC |
| InChI | InChI=1S/C9H21N.BrH/c1-5-9(6-2)10(7-3)8-4;/h9H,5-8H2,1-4H3;1H |
| InChIKey | NEGMDIIDZYWWPL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylpentan-3-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpentan-3-amine;hydrobromide?
The IUPAC name of N,N-diethylpentan-3-amine;hydrobromide (CID 175223065) is N,N-diethylpentan-3-amine;hydrobromide.
What is the SMILES notation for N,N-diethylpentan-3-amine;hydrobromide?
The canonical SMILES for N,N-diethylpentan-3-amine;hydrobromide is Br.CCC(CC)N(CC)CC.
What is the InChIKey of N,N-diethylpentan-3-amine;hydrobromide?
The InChIKey is NEGMDIIDZYWWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.BrH/c1-5-9(6-2)10(7-3)8-4;/h9H,5-8H2,1-4H3;1H.
What are the key properties of N,N-diethylpentan-3-amine;hydrobromide?
N,N-diethylpentan-3-amine;hydrobromide has a molecular weight of 224.19 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpentan-3-amine;hydrobromide is sourced from PubChem (CID 175223065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).