C5H11Cl2N — CID 12720695
N,N-dichloropentan-3-amine (PubChem CID 12720695) has the molecular formula C5H11Cl2N and a molecular weight of 156.06 g/mol. Its IUPAC name is N,N-dichloropentan-3-amine.
| Compound Name | N,N-dichloropentan-3-amine |
|---|---|
| PubChem CID | 12720695 |
| Molecular Formula | C5H11Cl2N |
| Molecular Weight | 156.06 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | N,N-dichloropentan-3-amine |
| SMILES | CCC(CC)N(Cl)Cl |
| InChI | InChI=1S/C5H11Cl2N/c1-3-5(4-2)8(6)7/h5H,3-4H2,1-2H3 |
| InChIKey | UIJUSVLMHNTXSE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|