C4H16N6 — CID 87261599
1-N,1-N,2-N,2-N-tetraaminobutane-1,2-diamine (PubChem CID 87261599) has the molecular formula C4H16N6 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetraaminobutane-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N-tetraaminobutane-1,2-diamine |
|---|---|
| PubChem CID | 87261599 |
| Molecular Formula | C4H16N6 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetraaminobutane-1,2-diamine |
| SMILES | CCC(CN(N)N)N(N)N |
| InChI | InChI=1S/C4H16N6/c1-2-4(10(7)8)3-9(5)6/h4H,2-3,5-8H2,1H3 |
| InChIKey | QUJZRALJTHDOHC-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|