C13H30FN — CID 174901011
N,N-diethyl-6-methyloctan-3-amine;hydrofluoride (PubChem CID 174901011) has the molecular formula C13H30FN and a molecular weight of 219.39 g/mol. Its IUPAC name is N,N-diethyl-6-methyloctan-3-amine;hydrofluoride.
| Compound Name | N,N-diethyl-6-methyloctan-3-amine;hydrofluoride |
|---|---|
| PubChem CID | 174901011 |
| Molecular Formula | C13H30FN |
| Molecular Weight | 219.39 g/mol |
| Exact Mass | 219.24 |
| IUPAC Name | N,N-diethyl-6-methyloctan-3-amine;hydrofluoride |
| SMILES | CCC(C)CCC(CC)N(CC)CC.F |
| InChI | InChI=1S/C13H29N.FH/c1-6-12(5)10-11-13(7-2)14(8-3)9-4;/h12-13H,6-11H2,1-5H3;1H |
| InChIKey | HOUJEFPVBYVMRG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |