C11H26N2 — CID 62439025
2-N,2-N-diethyl-1-N-propan-2-ylbutane-1,2-diamine (PubChem CID 62439025) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-N-propan-2-ylbutane-1,2-diamine.
| Compound Name | 2-N,2-N-diethyl-1-N-propan-2-ylbutane-1,2-diamine |
|---|---|
| PubChem CID | 62439025 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | 2-N,2-N-diethyl-1-N-propan-2-ylbutane-1,2-diamine |
| SMILES | CCC(CNC(C)C)N(CC)CC |
| InChI | InChI=1S/C11H26N2/c1-6-11(9-12-10(4)5)13(7-2)8-3/h10-12H,6-9H2,1-5H3 |
| InChIKey | VKOQFSHQOVLVFP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |