C24H54N4O — CID 139919620
1-N-[2-[2-[2-(diethylamino)butyl-ethylamino]ethoxy]ethyl]-1-N,2-N,2-N-triethylbutane-1,2-diamine (PubChem CID 139919620) has the molecular formula C24H54N4O and a molecular weight of 414.72 g/mol. Its IUPAC name is 1-N-[2-[2-[2-(diethylamino)butyl-ethylamino]ethoxy]ethyl]-1-N,2-N,2-N-triethylbutane-1,2-diamine.
| Compound Name | 1-N-[2-[2-[2-(diethylamino)butyl-ethylamino]ethoxy]ethyl]-1-N,2-N,2-N-triethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 139919620 |
| Molecular Formula | C24H54N4O |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.43 |
| IUPAC Name | 1-N-[2-[2-[2-(diethylamino)butyl-ethylamino]ethoxy]ethyl]-1-N,2-N,2-N-triethylbutane-1,2-diamine |
| SMILES | CCC(CN(CC)CCOCCN(CC)CC(CC)N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C24H54N4O/c1-9-23(27(13-5)14-6)21-25(11-3)17-19-29-20-18-26(12-4)22-24(10-2)28(15-7)16-8/h23-24H,9-22H2,1-8H3 |
| InChIKey | IPKWHKPFYJGYHL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|