C14H32N2O — CID 63759731
N'-[2-(3-methylbutoxy)ethyl]-N'-pentan-3-ylethane-1,2-diamine (PubChem CID 63759731) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is N'-[2-(3-methylbutoxy)ethyl]-N'-pentan-3-ylethane-1,2-diamine.
| Compound Name | N'-[2-(3-methylbutoxy)ethyl]-N'-pentan-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63759731 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | N'-[2-(3-methylbutoxy)ethyl]-N'-pentan-3-ylethane-1,2-diamine |
| SMILES | CCC(CC)N(CCN)CCOCCC(C)C |
| InChI | InChI=1S/C14H32N2O/c1-5-14(6-2)16(9-8-15)10-12-17-11-7-13(3)4/h13-14H,5-12,15H2,1-4H3 |
| InChIKey | MVBDIGGNRLGATR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|