C9H23N3 — CID 171585823
N,N',N",N"-tetraethylmethanetriamine (PubChem CID 171585823) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is N,N',N",N"-tetraethylmethanetriamine.
| Compound Name | N,N',N",N"-tetraethylmethanetriamine |
|---|---|
| PubChem CID | 171585823 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N,N',N",N"-tetraethylmethanetriamine |
| SMILES | CCNC(NCC)N(CC)CC |
| InChI | InChI=1S/C9H23N3/c1-5-10-9(11-6-2)12(7-3)8-4/h9-11H,5-8H2,1-4H3 |
| InChIKey | SCMPSOOWCWLBOG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|