C11H23F3N2O — CID 150089759
3-[2-ethyl-2-(3,3,3-trifluoro-2-methylpropyl)hydrazinyl]-3-methylbutan-1-ol (PubChem CID 150089759) has the molecular formula C11H23F3N2O and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-[2-ethyl-2-(3,3,3-trifluoro-2-methylpropyl)hydrazinyl]-3-methylbutan-1-ol.
| Compound Name | 3-[2-ethyl-2-(3,3,3-trifluoro-2-methylpropyl)hydrazinyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 150089759 |
| Molecular Formula | C11H23F3N2O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 3-[2-ethyl-2-(3,3,3-trifluoro-2-methylpropyl)hydrazinyl]-3-methylbutan-1-ol |
| SMILES | CCN(CC(C)C(F)(F)F)NC(C)(C)CCO |
| InChI | InChI=1S/C11H23F3N2O/c1-5-16(8-9(2)11(12,13)14)15-10(3,4)6-7-17/h9,15,17H,5-8H2,1-4H3 |
| InChIKey | DSYYEZRJLQKBER-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|