C7H15F3N2O3S — CID 114809835
3-methyl-3-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol (PubChem CID 114809835) has the molecular formula C7H15F3N2O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 3-methyl-3-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol.
| Compound Name | 3-methyl-3-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol |
|---|---|
| PubChem CID | 114809835 |
| Molecular Formula | C7H15F3N2O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-methyl-3-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol |
| SMILES | CC(C)(CCO)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O3S/c1-6(2,3-4-13)12-16(14,15)11-5-7(8,9)10/h11-13H,3-5H2,1-2H3 |
| InChIKey | IIPKSTZLEOAHFC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |