C6H13F3N2O3S — CID 106844053
4-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol (PubChem CID 106844053) has the molecular formula C6H13F3N2O3S and a molecular weight of 250.24 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol.
| Compound Name | 4-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol |
|---|---|
| PubChem CID | 106844053 |
| Molecular Formula | C6H13F3N2O3S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-(2,2,2-trifluoroethylsulfamoylamino)butan-1-ol |
| SMILES | O=S(=O)(NCCCCO)NCC(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O3S/c7-6(8,9)5-11-15(13,14)10-3-1-2-4-12/h10-12H,1-5H2 |
| InChIKey | MVEZTFWBJOWAIF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|