C6H11F3N2O4S — CID 114805476
2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (PubChem CID 114805476) has the molecular formula C6H11F3N2O4S and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.
| Compound Name | 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid |
|---|---|
| PubChem CID | 114805476 |
| Molecular Formula | C6H11F3N2O4S |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid |
| SMILES | CCC(NS(=O)(=O)NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H11F3N2O4S/c1-2-4(5(12)13)11-16(14,15)10-3-6(7,8)9/h4,10-11H,2-3H2,1H3,(H,12,13) |
| InChIKey | TVEAYQCLOCKYMA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |