2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid

C6H11F3N2O4S — CID 114805476

IUPAC2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid
SMILESCCC(NS(=O)(=O)NCC(F)(F)F)C(=O)O
InChIInChI=1S/C6H11F3N2O4S/c1-2-4(5(12)13)11-16(14,15)10-3-6(7,8)9/h4,10-11H,2-3H2,1H3,(H,12,13)
InChIKeyTVEAYQCLOCKYMA-UHFFFAOYSA-N
MW264.23 g/mol
LogP-0.16
Rot. Bonds6

About 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid

2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (PubChem CID 114805476) has the molecular formula C6H11F3N2O4S and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.

Molecular Properties

Compound Name2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid
PubChem CID114805476
Molecular FormulaC6H11F3N2O4S
Molecular Weight264.23 g/mol
Exact Mass264.04
IUPAC Name2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid
SMILESCCC(NS(=O)(=O)NCC(F)(F)F)C(=O)O
InChIInChI=1S/C6H11F3N2O4S/c1-2-4(5(12)13)11-16(14,15)10-3-6(7,8)9/h4,10-11H,2-3H2,1H3,(H,12,13)
InChIKeyTVEAYQCLOCKYMA-UHFFFAOYSA-N
XLogP-0.16
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 5-0.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
The IUPAC name of 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (CID 114805476) is 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.
What is the SMILES notation for 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
The canonical SMILES for 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid is CCC(NS(=O)(=O)NCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
The InChIKey is TVEAYQCLOCKYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2O4S/c1-2-4(5(12)13)11-16(14,15)10-3-6(7,8)9/h4,10-11H,2-3H2,1H3,(H,12,13).
What are the key properties of 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid?
2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid has a molecular weight of 264.23 g/mol, XLogP of -0.16, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid is sourced from PubChem (CID 114805476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).