C7H13F3N2O4S — CID 104977827
(2S)-3-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid (PubChem CID 104977827) has the molecular formula C7H13F3N2O4S and a molecular weight of 278.25 g/mol. Its IUPAC name is (2S)-3-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid.
| Compound Name | (2S)-3-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid |
|---|---|
| PubChem CID | 104977827 |
| Molecular Formula | C7H13F3N2O4S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (2S)-3-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)butanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H13F3N2O4S/c1-4(2)5(6(13)14)12-17(15,16)11-3-7(8,9)10/h4-5,11-12H,3H2,1-2H3,(H,13,14)/t5-/m0/s1 |
| InChIKey | NBAFJFZJFDQIFJ-YFKPBYRVSA-N |
| XLogP | 0.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |