C10H19F3N2O4S — CID 114806412
2-methyl-6-(2,2,2-trifluoroethylsulfamoylamino)heptanoic acid (PubChem CID 114806412) has the molecular formula C10H19F3N2O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-methyl-6-(2,2,2-trifluoroethylsulfamoylamino)heptanoic acid.
| Compound Name | 2-methyl-6-(2,2,2-trifluoroethylsulfamoylamino)heptanoic acid |
|---|---|
| PubChem CID | 114806412 |
| Molecular Formula | C10H19F3N2O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-methyl-6-(2,2,2-trifluoroethylsulfamoylamino)heptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O4S/c1-7(9(16)17)4-3-5-8(2)15-20(18,19)14-6-10(11,12)13/h7-8,14-15H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | PEBDRZNFFXGFIS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |