C11H13F3N2O4S — CID 122067949
3-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]butanoic acid (PubChem CID 122067949) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]butanoic acid.
| Compound Name | 3-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 122067949 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-methyl-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]butanoic acid |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(C(F)(F)F)nc1)C(=O)O |
| InChI | InChI=1S/C11H13F3N2O4S/c1-6(2)9(10(17)18)16-21(19,20)7-3-4-8(15-5-7)11(12,13)14/h3-6,9,16H,1-2H3,(H,17,18) |
| InChIKey | POHMWENSUXVSQK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |