C9H23N3 — CID 134919142
N",N"-diethyl-N,N,N',N'-tetramethylmethanetriamine (PubChem CID 134919142) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is N",N"-diethyl-N,N,N',N'-tetramethylmethanetriamine.
| Compound Name | N",N"-diethyl-N,N,N',N'-tetramethylmethanetriamine |
|---|---|
| PubChem CID | 134919142 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N",N"-diethyl-N,N,N',N'-tetramethylmethanetriamine |
| SMILES | CCN(CC)C(N(C)C)N(C)C |
| InChI | InChI=1S/C9H23N3/c1-7-12(8-2)9(10(3)4)11(5)6/h9H,7-8H2,1-6H3 |
| InChIKey | UMJONDHWFJLLRU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|