C7H13KN2O6 — CID 87238966
potassium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;2-(methylamino)acetic acid (PubChem CID 87238966) has the molecular formula C7H13KN2O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is potassium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;2-(methylamino)acetic acid.
| Compound Name | potassium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 87238966 |
| Molecular Formula | C7H13KN2O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | potassium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;2-(methylamino)acetic acid |
| SMILES | CNCC(=O)O.N[C@@H](CC(=O)O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C4H7NO4.C3H7NO2.K/c5-2(4(8)9)1-3(6)7;1-4-2-3(5)6;/h2H,1,5H2,(H,6,7)(H,8,9);4H,2H2,1H3,(H,5,6);/q;;+1/p-1/t2-;;/m0../s1 |
| InChIKey | XXBPKJLJRSNEEH-JIZZDEOASA-M |
| XLogP | -6.17 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |