C9H14N2Na2O8 — CID 131731808
disodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;(2S)-2-amino-5-hydroxy-5-oxopentanoate (PubChem CID 131731808) has the molecular formula C9H14N2Na2O8 and a molecular weight of 324.20 g/mol. Its IUPAC name is disodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;(2S)-2-amino-5-hydroxy-5-oxopentanoate.
| Compound Name | disodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;(2S)-2-amino-5-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 131731808 |
| Molecular Formula | C9H14N2Na2O8 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | disodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;(2S)-2-amino-5-hydroxy-5-oxopentanoate |
| SMILES | N[C@@H](CC(=O)O)C(=O)[O-].N[C@@H](CCC(=O)O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO4.C4H7NO4.2Na/c6-3(5(9)10)1-2-4(7)8;5-2(4(8)9)1-3(6)7;;/h3H,1-2,6H2,(H,7,8)(H,9,10);2H,1,5H2,(H,6,7)(H,8,9);;/q;;2*+1/p-2/t3-;2-;;/m00../s1 |
| InChIKey | ZYWPXPKNTWCHFM-AKMQRXGGSA-L |
| XLogP | -10.53 |
| TPSA | 206.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | -10.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |