C8H13NNa2O8 — CID 163675970
disodium;acetic acid;(2S)-2-aminobutanedioate (PubChem CID 163675970) has the molecular formula C8H13NNa2O8 and a molecular weight of 297.17 g/mol. Its IUPAC name is disodium;acetic acid;(2S)-2-aminobutanedioate.
| Compound Name | disodium;acetic acid;(2S)-2-aminobutanedioate |
|---|---|
| PubChem CID | 163675970 |
| Molecular Formula | C8H13NNa2O8 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | disodium;acetic acid;(2S)-2-aminobutanedioate |
| SMILES | CC(=O)O.CC(=O)O.N[C@@H](CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H7NO4.2C2H4O2.2Na/c5-2(4(8)9)1-3(6)7;2*1-2(3)4;;/h2H,1,5H2,(H,6,7)(H,8,9);2*1H3,(H,3,4);;/q;;;2*+1/p-2/t2-;;;;/m0..../s1 |
| InChIKey | JGSQTYZVDPZCGB-AIDJSRAFSA-L |
| XLogP | -9.61 |
| TPSA | 180.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | -9.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |