C21H28N2O6 — CID 143231603
2-[2-[carboxymethyl-[[2-(hydroxymethyl)phenyl]methyl]amino]ethylamino]acetic acid;2-methylphenol (PubChem CID 143231603) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[[2-(hydroxymethyl)phenyl]methyl]amino]ethylamino]acetic acid;2-methylphenol.
| Compound Name | 2-[2-[carboxymethyl-[[2-(hydroxymethyl)phenyl]methyl]amino]ethylamino]acetic acid;2-methylphenol |
|---|---|
| PubChem CID | 143231603 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2-[2-[carboxymethyl-[[2-(hydroxymethyl)phenyl]methyl]amino]ethylamino]acetic acid;2-methylphenol |
| SMILES | Cc1ccccc1O.O=C(O)CNCCN(CC(=O)O)Cc1ccccc1CO |
| InChI | InChI=1S/C14H20N2O5.C7H8O/c17-10-12-4-2-1-3-11(12)8-16(9-14(20)21)6-5-15-7-13(18)19;1-6-4-2-3-5-7(6)8/h1-4,15,17H,5-10H2,(H,18,19)(H,20,21);2-5,8H,1H3 |
| InChIKey | ZFVQGRDITANVRM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|