C25H34N2O6 — CID 67702833
2-[2-[[2-[1-(2-hydroxyphenyl)hexan-2-yloxy]-2-oxoethyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid (PubChem CID 67702833) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[2-[[2-[1-(2-hydroxyphenyl)hexan-2-yloxy]-2-oxoethyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[2-[[2-[1-(2-hydroxyphenyl)hexan-2-yloxy]-2-oxoethyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 67702833 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[2-[[2-[1-(2-hydroxyphenyl)hexan-2-yloxy]-2-oxoethyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid |
| SMILES | CCCCC(Cc1ccccc1O)OC(=O)CNCCN(CC(=O)O)Cc1ccccc1O |
| InChI | InChI=1S/C25H34N2O6/c1-2-3-10-21(15-19-8-4-6-11-22(19)28)33-25(32)16-26-13-14-27(18-24(30)31)17-20-9-5-7-12-23(20)29/h4-9,11-12,21,26,28-29H,2-3,10,13-18H2,1H3,(H,30,31) |
| InChIKey | VBBYIFOEGCTZEP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|