C30H44N2O7 — CID 159726623
2-[[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]-8-oxoundecyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid;methane (PubChem CID 159726623) has the molecular formula C30H44N2O7 and a molecular weight of 544.69 g/mol. Its IUPAC name is 2-[[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]-8-oxoundecyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid;methane.
| Compound Name | 2-[[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]-8-oxoundecyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid;methane |
|---|---|
| PubChem CID | 159726623 |
| Molecular Formula | C30H44N2O7 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 2-[[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]-8-oxoundecyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid;methane |
| SMILES | C.CCCC(=O)CCCCCC(CN(CC(=O)O)Cc1ccccc1O)N(CC(=O)O)Cc1ccccc1O |
| InChI | InChI=1S/C29H40N2O7.CH4/c1-2-10-25(32)14-5-3-4-13-24(31(21-29(37)38)18-23-12-7-9-16-27(23)34)19-30(20-28(35)36)17-22-11-6-8-15-26(22)33;/h6-9,11-12,15-16,24,33-34H,2-5,10,13-14,17-21H2,1H3,(H,35,36)(H,37,38);1H4 |
| InChIKey | NASGFFMAPBUACI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|