C24H33N3O6 — CID 90087226
2-[[6-amino-2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]hexyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid (PubChem CID 90087226) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-[[6-amino-2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]hexyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]hexyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 90087226 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-[[6-amino-2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]hexyl]-[(2-hydroxyphenyl)methyl]amino]acetic acid |
| SMILES | NCCCCC(CN(CC(=O)O)Cc1ccccc1O)N(CC(=O)O)Cc1ccccc1O |
| InChI | InChI=1S/C24H33N3O6/c25-12-6-5-9-20(27(17-24(32)33)14-19-8-2-4-11-22(19)29)15-26(16-23(30)31)13-18-7-1-3-10-21(18)28/h1-4,7-8,10-11,20,28-29H,5-6,9,12-17,25H2,(H,30,31)(H,32,33) |
| InChIKey | QFXUOPKFQVVYTP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 147.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|