C28H40N2O6 — CID 145180691
6-[2-[5-carboxypentyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]hexanoic acid (PubChem CID 145180691) has the molecular formula C28H40N2O6 and a molecular weight of 500.64 g/mol. Its IUPAC name is 6-[2-[5-carboxypentyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]hexanoic acid.
| Compound Name | 6-[2-[5-carboxypentyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145180691 |
| Molecular Formula | C28H40N2O6 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 6-[2-[5-carboxypentyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCN(CCN(CCCCCC(=O)O)Cc1ccccc1O)Cc1ccccc1O |
| InChI | InChI=1S/C28H40N2O6/c31-25-13-7-5-11-23(25)21-29(17-9-1-3-15-27(33)34)19-20-30(18-10-2-4-16-28(35)36)22-24-12-6-8-14-26(24)32/h5-8,11-14,31-32H,1-4,9-10,15-22H2,(H,33,34)(H,35,36) |
| InChIKey | LECCDEDEUXQJCT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|