C15H18N2O4 — CID 82327931
4-[2-carboxyethyl-[(2-cyanophenyl)methyl]amino]butanoic acid (PubChem CID 82327931) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[2-carboxyethyl-[(2-cyanophenyl)methyl]amino]butanoic acid.
| Compound Name | 4-[2-carboxyethyl-[(2-cyanophenyl)methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 82327931 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[2-carboxyethyl-[(2-cyanophenyl)methyl]amino]butanoic acid |
| SMILES | N#Cc1ccccc1CN(CCCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C15H18N2O4/c16-10-12-4-1-2-5-13(12)11-17(9-7-15(20)21)8-3-6-14(18)19/h1-2,4-5H,3,6-9,11H2,(H,18,19)(H,20,21) |
| InChIKey | BONPQHKVISBCPF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |