C28H54N2O4+2 — CID 122204638
(4,8-dimethyl-2,6-dioxononyl)-[2-[(4,8-dimethyl-2,6-dioxononyl)-dimethylazaniumyl]ethyl]-dimethylazanium (PubChem CID 122204638) has the molecular formula C28H54N2O4+2 and a molecular weight of 482.75 g/mol. Its IUPAC name is (4,8-dimethyl-2,6-dioxononyl)-[2-[(4,8-dimethyl-2,6-dioxononyl)-dimethylazaniumyl]ethyl]-dimethylazanium.
| Compound Name | (4,8-dimethyl-2,6-dioxononyl)-[2-[(4,8-dimethyl-2,6-dioxononyl)-dimethylazaniumyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 122204638 |
| Molecular Formula | C28H54N2O4+2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | (4,8-dimethyl-2,6-dioxononyl)-[2-[(4,8-dimethyl-2,6-dioxononyl)-dimethylazaniumyl]ethyl]-dimethylazanium |
| SMILES | CC(C)CC(=O)CC(C)CC(=O)C[N+](C)(C)CC[N+](C)(C)CC(=O)CC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C28H54N2O4/c1-21(2)13-25(31)15-23(5)17-27(33)19-29(7,8)11-12-30(9,10)20-28(34)18-24(6)16-26(32)14-22(3)4/h21-24H,11-20H2,1-10H3/q+2 |
| InChIKey | YTRZCWVSAFNBFG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|