C19H38O2 — CID 167674911
2,6-dimethylheptan-4-one;2,2,6-trimethylheptan-4-one (PubChem CID 167674911) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-one;2,2,6-trimethylheptan-4-one.
| Compound Name | 2,6-dimethylheptan-4-one;2,2,6-trimethylheptan-4-one |
|---|---|
| PubChem CID | 167674911 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 2,6-dimethylheptan-4-one;2,2,6-trimethylheptan-4-one |
| SMILES | CC(C)CC(=O)CC(C)(C)C.CC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C10H20O.C9H18O/c1-8(2)6-9(11)7-10(3,4)5;1-7(2)5-9(10)6-8(3)4/h8H,6-7H2,1-5H3;7-8H,5-6H2,1-4H3 |
| InChIKey | UQZSGSACHSAMAK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |