C13H23NO — CID 154092400
2,6-dimethyl-2-(2-methylpropyl)-4-oxoheptanenitrile (PubChem CID 154092400) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,6-dimethyl-2-(2-methylpropyl)-4-oxoheptanenitrile.
| Compound Name | 2,6-dimethyl-2-(2-methylpropyl)-4-oxoheptanenitrile |
|---|---|
| PubChem CID | 154092400 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,6-dimethyl-2-(2-methylpropyl)-4-oxoheptanenitrile |
| SMILES | CC(C)CC(=O)CC(C)(C#N)CC(C)C |
| InChI | InChI=1S/C13H23NO/c1-10(2)6-12(15)8-13(5,9-14)7-11(3)4/h10-11H,6-8H2,1-5H3 |
| InChIKey | FRMSFDUXSKJDMA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |