C22H40O4Zn — CID 159095864
bis(2,2,7-trimethyloctane-3,5-dione);zinc (PubChem CID 159095864) has the molecular formula C22H40O4Zn and a molecular weight of 433.95 g/mol. Its IUPAC name is bis(2,2,7-trimethyloctane-3,5-dione);zinc.
| Compound Name | bis(2,2,7-trimethyloctane-3,5-dione);zinc |
|---|---|
| PubChem CID | 159095864 |
| Molecular Formula | C22H40O4Zn |
| Molecular Weight | 433.95 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | bis(2,2,7-trimethyloctane-3,5-dione);zinc |
| SMILES | CC(C)CC(=O)CC(=O)C(C)(C)C.CC(C)CC(=O)CC(=O)C(C)(C)C.[Zn] |
| InChI | InChI=1S/2C11H20O2.Zn/c2*1-8(2)6-9(12)7-10(13)11(3,4)5;/h2*8H,6-7H2,1-5H3; |
| InChIKey | KCQUKWBNBSYDMR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|