About 1-hydroxypropan-2-one;methane
1-hydroxypropan-2-one;methane (PubChem CID 159772503) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is 1-hydroxypropan-2-one;methane.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-one;methane |
| PubChem CID | 159772503 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | 1-hydroxypropan-2-one;methane |
| SMILES | C.CC(=O)CO |
| InChI | InChI=1S/C3H6O2.CH4/c1-3(5)2-4;/h4H,2H2,1H3;1H4 |
| InChIKey | NGHIZIZYLUZQNZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hydroxypropan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-one;methane?
The IUPAC name of 1-hydroxypropan-2-one;methane (CID 159772503) is 1-hydroxypropan-2-one;methane.
What is the SMILES notation for 1-hydroxypropan-2-one;methane?
The canonical SMILES for 1-hydroxypropan-2-one;methane is C.CC(=O)CO.
What is the InChIKey of 1-hydroxypropan-2-one;methane?
The InChIKey is NGHIZIZYLUZQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.CH4/c1-3(5)2-4;/h4H,2H2,1H3;1H4.
What are the key properties of 1-hydroxypropan-2-one;methane?
1-hydroxypropan-2-one;methane has a molecular weight of 90.12 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-one;methane is sourced from PubChem (CID 159772503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).