About calcium;hydride;3-methylbutaneperoxoic acid
calcium;hydride;3-methylbutaneperoxoic acid (PubChem CID 174798211) has the molecular formula C5H12CaO3
and a molecular weight of 160.23 g/mol. Its IUPAC name is calcium;hydride;3-methylbutaneperoxoic acid.
Molecular Properties
| Compound Name | calcium;hydride;3-methylbutaneperoxoic acid |
| PubChem CID | 174798211 |
| Molecular Formula | C5H12CaO3 |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | calcium;hydride;3-methylbutaneperoxoic acid |
| SMILES | CC(C)CC(=O)OO.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C5H10O3.Ca.2H/c1-4(2)3-5(6)8-7;;;/h4,7H,3H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | JIPKQCQQJBEBRA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;3-methylbutaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;3-methylbutaneperoxoic acid?
The IUPAC name of calcium;hydride;3-methylbutaneperoxoic acid (CID 174798211) is calcium;hydride;3-methylbutaneperoxoic acid.
What is the SMILES notation for calcium;hydride;3-methylbutaneperoxoic acid?
The canonical SMILES for calcium;hydride;3-methylbutaneperoxoic acid is CC(C)CC(=O)OO.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;3-methylbutaneperoxoic acid?
The InChIKey is JIPKQCQQJBEBRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.Ca.2H/c1-4(2)3-5(6)8-7;;;/h4,7H,3H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;3-methylbutaneperoxoic acid?
calcium;hydride;3-methylbutaneperoxoic acid has a molecular weight of 160.23 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;3-methylbutaneperoxoic acid is sourced from PubChem (CID 174798211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).