About nitroso 3-methylbutanoate
nitroso 3-methylbutanoate (PubChem CID 174302383) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is nitroso 3-methylbutanoate.
Molecular Properties
| Compound Name | nitroso 3-methylbutanoate |
| PubChem CID | 174302383 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | nitroso 3-methylbutanoate |
| SMILES | CC(C)CC(=O)ON=O |
| InChI | InChI=1S/C5H9NO3/c1-4(2)3-5(7)9-6-8/h4H,3H2,1-2H3 |
| InChIKey | CSYZVCBGUILMHR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitroso 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroso 3-methylbutanoate?
The IUPAC name of nitroso 3-methylbutanoate (CID 174302383) is nitroso 3-methylbutanoate.
What is the SMILES notation for nitroso 3-methylbutanoate?
The canonical SMILES for nitroso 3-methylbutanoate is CC(C)CC(=O)ON=O.
What is the InChIKey of nitroso 3-methylbutanoate?
The InChIKey is CSYZVCBGUILMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-4(2)3-5(7)9-6-8/h4H,3H2,1-2H3.
What are the key properties of nitroso 3-methylbutanoate?
nitroso 3-methylbutanoate has a molecular weight of 131.13 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitroso 3-methylbutanoate is sourced from PubChem (CID 174302383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).